| Name |
10-O-Methylsarpagine 10-Methoxynormacusine B Lochnerine |
| Formula |
C20H24N2O2 |
| Mw |
324.18377802 |
| CAS RN |
522-47-4 |
| C_ID |
C00027069
, 
|
| InChIKey |
YTIVOMMYBBBYFH-MXQQRHMSNA-N |
| InChICode |
InChI=1S/C20H24N2O2/c1-3-11-9-22-18-8-15-14-6-12(24-2)4-5-17(14)21-20(15)19(22)7-13(11)16(18)10-23/h3-6,13,16,18-19,21,23H,7-10H2,1-2H3/b11-3-/t13-,16+,18-,19-/m0/s1 |
| SMILES |
C/C=C1/C[N@@]2[C@H]3CC1[C@@H](CO)[C@@H]2Cc1c3[nH]c2ccc(OC)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Alstonia angustifolia | Ref. |
| Plantae | Apocynaceae | Alstonia angustifolia var.latifolia | Ref. |
| Plantae | Apocynaceae | Alstonia macrophylla  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Rauvolfia bahiensis | Ref. |
| Plantae | Apocynaceae | Rauwolfia sprucei Muell. | Ref. |
| Plantae | Apocynaceae | Vinca rosea L.  | Ref. |
| Plantae | Longaniaceae | Strychnos toxifera Schomb.  | Ref. |
|
|
zoom in
| Organism | Catharanthus roseus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11 |
|---|
|