| Name |
5'-Acetyllasiocarpine Acetyllasiocarpine Lasiocarpine monoacetate |
| Formula |
C23H35NO8 |
| Mw |
453.2362671 |
| CAS RN |
57538-10-0 |
| C_ID |
C00026180
, 
|
| InChIKey |
XGLOPSNBSMBXSE-GUDPYABHNA-N |
| InChICode |
InChI=1S/C23H35NO8/c1-8-14(2)20(26)31-18-10-12-24-11-9-17(19(18)24)13-30-21(27)23(28,15(3)29-7)22(5,6)32-16(4)25/h8-9,15,18-19,28H,10-13H2,1-7H3/b14-8-/t15-,18-,19+,23-/m0/s1 |
| SMILES |
C/C=C(/C)C(=O)O[C@H]1CCN2CC=C(COC(=O)[C@@](O)([C@H](C)OC)C(C)(C)OC(C)=O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Boraginaceae | Heliotropium bovei | Ref. |
| Plantae | Boraginaceae | Heliotropium europaeum  | Ref. |
| Plantae | Boraginaceae | Heliotropium europeum | Ref. |
| Plantae | Boraginaceae | Heliotropium hirsutissimum | Ref. |
|
|
zoom in
| Organism | Heliotropium hirsutissimum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|