| Name |
7-Acetyllycopsamine Acetyllycopsamine Lycopsamine 1-acetate |
| Formula |
C17H27NO6 |
| Mw |
341.1838376 |
| CAS RN |
73544-48-6 |
| C_ID |
C00026164
, 
|
| InChIKey |
RKDOFSJTBIDAHX-RSGODLMTNA-N |
| InChICode |
InChI=1S/C17H27NO6/c1-10(2)17(22,11(3)19)16(21)23-9-13-5-7-18-8-6-14(15(13)18)24-12(4)20/h5,10-11,14-15,19,22H,6-9H2,1-4H3/t11-,14+,15+,17-/m0/s1 |
| SMILES |
CC(=O)O[C@@H]1CCN2CC=C(COC(=O)[C@](O)(C(C)C)[C@H](C)O)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Ala L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Boraginaceae | Echium horridum | Ref. |
| Plantae | Boraginaceae | Echium rauwolfii | Ref. |
| Plantae | Boraginaceae | Lithospermum canesens | Ref. |
| Plantae | Boraginaceae | Symphytum x.uplandicum | Ref. |
|
|
zoom in
| Organism | Lithospermum canesens | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|