| Name |
Orientalidine Bractavine |
| Formula |
C22H23NO6 |
| Mw |
397.15253747 |
| CAS RN |
23943-90-0 |
| C_ID |
C00026140
, 
|
| InChIKey |
QJZHAQOTBKWPGS-XISACWJONA-N |
| InChICode |
InChI=1S/C22H23NO6/c1-24-17-6-13-8-23-4-3-12-5-18-21(29-11-27-18)22(25-2)19(12)16(23)7-14(13)15-9-26-10-28-20(15)17/h5-6,16H,3-4,7-11H2,1-2H3/t16-/m0/s1 |
| SMILES |
COc1cc2c(c3c1OCOC3)C[C@H]1c3c(cc4c(c3OC)OCO4)CCN1C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Papaveraceae | Papaver bracteatum Lindl.  | Ref. |
| Plantae | Papaveraceae | Papaver macrantha | Ref. |
| Plantae | Papaveraceae | Papaver orientale L.  | Ref. |
| Plantae | Papaveraceae | Papaver pseudo-orientale | Ref. |
| Plantae | Papaveraceae | Papaver pseudoorientale | Ref. |
|
|
zoom in
| Organism | Papaver pseudo-orientale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|