| Name |
Pleiocarpamine (+)-Pleiocarpamine |
| Formula |
C20H22N2O2 |
| Mw |
322.16812796 |
| CAS RN |
6393-66-4 |
| C_ID |
C00026013
, 
|
| InChIKey |
NTMOAQDHNZYZMZ-KGVSQERTNA-N |
| InChICode |
InChI=1S/C20H22N2O2/c1-3-12-11-21-9-8-14-13-6-4-5-7-16(13)22-18(14)17(21)10-15(12)19(22)20(23)24-2/h3-7,15,17,19H,8-11H2,1-2H3/b12-3+/t15-,17-,19+/m0/s1 |
| SMILES |
C/C=C1CN2CCc3c4n(c5ccccc35)C(C(=O)OC)C1CC42 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Hunteria eburnea Pichon. | Ref. |
| Plantae | Apocynaceae | Kopsia dasyrachis | Ref. |
| Plantae | Apocynaceae | Kopsia fruticosa | Ref. |
| Plantae | Apocynaceae | Ochrosia elliptica Labill. | Ref. |
| Plantae | Apocynaceae | Pleiocarpa mutica Benth. | Ref. |
| Plantae | Apocynaceae | Strempeliopsis strempelioides K.Schum. | Ref. |
| Plantae | Apocynaceae | Tabernaemontana echinata Vell. | Ref. |
| Plantae | Apocynaceae | Tabernaemontana siphilitica Leeuwenberg | Ref. |
|
|
zoom in
| Organism | Kopsia fruticosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Kam, et al., Phytochemistry, 65, (2004), 2119 |
|---|
|