| Name |
Voacristine hydroxyindolenine (19S)-Voacristine hydroxyindolenine (20S)-Voacristine hydroxyindolenine Voacangarine 7-hydroxyindolenine Voacristine 7-hydroxyindolenine |
| Formula |
C22H28N2O5 |
| Mw |
400.19982202 |
| CAS RN |
15215-86-8 |
| C_ID |
C00025228
, 
|
| InChIKey |
MMANMJCGIGNJGH-HNYLBJKUNA-N |
| InChICode |
InChI=1S/C22H28N2O5/c1-12(25)15-8-13-10-21(20(26)29-3)18(15)24(11-13)7-6-22(27)16-9-14(28-2)4-5-17(16)23-19(21)22/h4-5,9,12-13,15,18,25,27H,6-8,10-11H2,1-3H3/t12-,13+,15+,18-,21-,22+/m0/s1 |
| SMILES |
COC(=O)[C@@]12C[C@H]3C[C@H]([C@H](C)O)[C@@H]1[N@@](CC[C@]1(O)C2=Nc2ccc(OC)cc21)C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Ervatamia coronaria (Jacq.) | Ref. |
| Plantae | Apocynaceae | Tabernaemontana apoda Wr.ex Sauv. | Ref. |
| Plantae | Apocynaceae | Tabernaemontana dichotoma Roxb.ex Wall  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana heyneana  | Ref. |
| Plantae | Apocynaceae | Voacanga africana Stapf.  | Ref. |
|
|
zoom in
| Organism | Tabernaemontana heyneana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|