| Name |
Cadambine |
| Formula |
C27H32N2O10 |
| Mw |
544.20569526 |
| CAS RN |
54422-49-0 |
| C_ID |
C00025157
, 
|
| InChIKey |
OVRROYYXOBYCSR-CZAVMTDFNA-N |
| InChICode |
InChI=1S/C27H32N2O10/c1-35-24(34)15-11-36-25(38-26-22(33)21(32)20(31)18(10-30)37-26)19-14(15)8-27-23-13(6-7-29(27)9-17(19)39-27)12-4-2-3-5-16(12)28-23/h2-5,11,14,17-22,25-26,28,30-33H,6-10H2,1H3/t14-,17+,18-,19+,20+,21+,22+,25+,26+,27+/m1/s1 |
| SMILES |
COC(=O)C1=CO[C@@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)[C@@H]2[C@@H]3CN4CCc5c([nH]c6ccccc56)C4(C[C@H]12)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Adina cordifolia Hook.f.  | Ref. |
| Plantae | Rubiaceae | Anthocephalus cadamba | Ref. |
| Plantae | Rubiaceae | Nauclea cadamba ROXB. | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla | Ref. |
|
|
zoom in
| Organism | Uncaria rhynchophylla |
|---|
| Reference | Kang, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 762.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|
