| Name |
26,27-Dihydroxylanosta-7,9(11),24-trien-3-one Ganoderiol F |
| Formula |
C30H46O3 |
| Mw |
454.34469533 |
| CAS RN |
114567-47-4 |
| C_ID |
C00023862
, 
|
| InChIKey |
JVGJXXNUVVQEIG-QMDAWEORNA-N |
| InChICode |
InChI=1S/C30H46O3/c1-20(8-7-9-21(18-31)19-32)22-12-16-30(6)24-10-11-25-27(2,3)26(33)14-15-28(25,4)23(24)13-17-29(22,30)5/h9-10,13,20,22,25,31-32H,7-8,11-12,14-19H2,1-6H3/t20-,22-,25-,28-,29-,30+/m1/s1 |
| SMILES |
C[C@H](CCC=C(CO)CO)[C@H]1CC[C@@]2(C)C3=CC[C@H]4C(C)(C)C(=O)CC[C@]4(C)C3=CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma concinna | Ref. |
| Fungi | Ganodermataceae | Ganoderma lipiense | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| - | - | Metab. of Ganoderma lucidum | Ref. |
|
|
zoom in
| Organism | Metab. of Ganoderma lucidum | | Reference | Sato, H. et al., Agric. Biol. Chem., 1986, 50, 2887 (isol) |
|---|
|