| Name |
Ergost-5-en-3beta-ol
7,(24S)24-Methylcholest-5-en-3beta-ol
24-Epicampesterol
24S-Methyl cholesterol
Dihydrobrassicasterol |
| Formula |
C28H48O |
| Mw |
400.37051615 |
| CAS RN |
4651-51-8 |
| C_ID |
C00023756
, 
|
| InChIKey |
SGNBVLSWZMBQTH-BNDLDBAFNA-N |
| InChICode |
InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20+,22-,23-,24+,25-,26?,27-,28+/m0/s1 |
| SMILES |
CC(C)[C@@H](C)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Fungi | Arthrodermataceae | Trichophyton mentagrophytes | Ref. |
| Fungi | Nectriaceae | Fusarium culmorum | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica | Ref. |
| - | - | Chloromorum toxicum | Ref. |
| - | - | Crotone hieronymi | Ref. |
| - | - | Hyphochytrium catenoides | Ref. |
| - | - | Sinularia dura | Ref. |
|
|
zoom in
| Organism | Fusarium culmorum |
|---|
| Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids
Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II
Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function of Sterols in Fungi,Advances in Lipid Rese |
|---|
|
