| Name |
9-Methoxyaristolactam I 9-Methoxyaristololactam I |
| Formula |
C18H13NO5 |
| Mw |
323.07937253 |
| CAS RN |
133462-30-3 |
| C_ID |
C00021676
, 
|
| InChIKey |
LGDDKZBOKLRXPS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H13NO5/c1-21-10-5-3-4-8-12(10)17(22-2)15-13-9(18(20)19-15)6-11-16(14(8)13)24-7-23-11/h3-6H,7H2,1-2H3,(H,19,20) |
| SMILES |
COc1cccc2c1c(OC)c1c3c(cc4c(c32)OCO4)C(=O)N1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia auricularia | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
| Plantae | Aristolochiaceae | Aristolochia ponticum | Ref. |
|
|
zoom in
| Organism | Aristolochia mollissima | | Reference | Wu, et al., Journal of Natural Products, 64, (2001), 71.
Wu, et al., Journal of Natural Products, 66, (2003), 996 |
|---|
|