| Name |
Tetraneurin B |
| Formula |
C17H22O6 |
| Mw |
322.14163844 |
| CAS RN |
28587-45-3 |
| C_ID |
C00021157
, 
|
| InChIKey |
QRTSCMLACFOJIC-ASJIGOEYNA-N |
| InChICode |
InChI=1S/C17H22O6/c1-9-4-5-12-10(2)15(20)23-14(12)16(8-22-11(3)18)13(19)6-7-17(9,16)21/h9,12,14,21H,2,4-8H2,1,3H3/t9-,12-,14+,16-,17+/m0/s1 |
| SMILES |
C=C1C(=O)O[C@@H]2[C@H]1CC[C@H](C)[C@]1(O)CCC(=O)[C@@]21COC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Parthenium alpinum | Ref. |
| Plantae | Asteraceae | Parthenium fruticosum | Ref. |
| Plantae | Asteraceae | Parthenium lozanianum | Ref. |
| - | - | family Asteraceae spp. | Ref. |
|
|
zoom in
| Organism | family Asteraceae spp. | | Reference | Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|