| Name |
Manshurolide |
| Formula |
C15H20O2 |
| Mw |
232.14632988 |
| CAS RN |
128232-71-3 |
| C_ID |
C00012469
, 
|
| InChIKey |
JOQILOMKLDOWGX-PNFBFNDGNA-N |
| InChICode |
InChI=1S/C15H20O2/c1-11-5-3-7-12(2)9-14-10-13(8-4-6-11)15(16)17-14/h6-7,10,14H,3-5,8-9H2,1-2H3/b11-6+,12-7+/t14-/m0/s1 |
| SMILES |
C/C1=CCCC2=C[C@H](C/C(C)=C/CC1)OC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aristolochiaceae | Aristolochia cucurbitafolia  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Aristolochiaceae | Aristolochia mollissima | Ref. |
|
|
zoom in
| Organism | Aristolochia mollissima | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Wu, et al., Journal of Natural Products, 64, (2001), 71 |
|---|
|