| Name |
(-)-4-Terpineol (R)-(-)-p-Menth-1-en-4-ol (-)-Terpinene-4-ol Terpinene-4-ol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
20126-76-5 |
| C_ID |
C00010927
, 
|
| InChIKey |
WRYLYDPHFGVWKC-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m0/s1 |
| SMILES |
CC1=CC[C@@](O)(C(C)C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Lychnophora ericoides Mart.  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus dives  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Rutaceae | Zanthoxylum rhetsa  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Origanum vulgare | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|