| Name |
6-O-Methyl catalpol 6-O-Methylcatalpol |
| Formula |
C16H24O10 |
| Mw |
376.13694699 |
| CAS RN |
1617-84-1 |
| C_ID |
C00010518
, 
|
| InChIKey |
CQHVYUDLQLYNAI-ZLYCEKSLNA-N |
| InChICode |
InChI=1S/C16H24O10/c1-22-12-6-2-3-23-14(8(6)16(5-18)13(12)26-16)25-15-11(21)10(20)9(19)7(4-17)24-15/h2-3,6-15,17-21H,4-5H2,1H3/t6-,7+,8+,9+,10-,11-,12-,13-,14-,15-,16+/m0/s1 |
| SMILES |
CO[C@H]1[C@@H]2C=CO[C@@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)[C@@H]2[C@@]2(CO)O[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Buddlejaceae | Buddleia globosa | Ref. |
| Plantae | Buddlejaceae | Buddleia variabilis | Ref. |
| Plantae | Buddlejaceae | Buddleja globosa  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia dentata | Ref. |
| Plantae | Scrophulariaceae | Scrophularia lepidota | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoenis | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|