| Name |
Iristectorigenin A 7-O-glucoside
Iristectorin A |
| Formula |
C23H24O12 |
| Mw |
492.12677623 |
| CAS RN |
37744-61-9 |
| C_ID |
C00010131
, 
|
| InChIKey |
HFODKTZIQVSGJO-DITHNNADNA-N |
| InChICode |
InChI=1S/C23H24O12/c1-31-12-4-3-9(5-11(12)25)10-8-33-13-6-14(22(32-2)19(28)16(13)17(10)26)34-23-21(30)20(29)18(27)15(7-24)35-23/h3-6,8,15,18,20-21,23-25,27-30H,7H2,1-2H3/t15-,18-,20+,21+,23-/m1/s1 |
| SMILES |
COc1ccc(-c2coc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c(OC)c(O)c3c2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Iridaceae | Belamcanda chinensis  | Ref. |
| Plantae | Iridaceae | Iris spuria | Ref. |
| Plantae | Iridaceae | Iris tectorum | Ref. |
| - | - | Actinida polygama | Ref. |
|
|
zoom in
| Organism | Actinida polygama |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|
