| Name |
Prunetin 4'-O-glucoside Prunetrin Prunitrin Prunitroside Trifoside |
| Formula |
C22H22O10 |
| Mw |
446.12129692 |
| CAS RN |
154-36-9 |
| C_ID |
C00010118
, 
|
| InChIKey |
OFUWGCQDMVDLIR-RSBVYOOMNA-N |
| InChICode |
InChI=1S/C22H22O10/c1-29-12-6-14(24)17-15(7-12)30-9-13(18(17)25)10-2-4-11(5-3-10)31-22-21(28)20(27)19(26)16(8-23)32-22/h2-7,9,16,19-24,26-28H,8H2,1H3/t16-,19+,20-,21-,22+/m0/s1 |
| SMILES |
COc1cc(O)c2c(=O)c(-c3ccc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3)coc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia sissoo  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium spp. | Ref. |
| Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
| Plantae | Rosaceae | Prunus spp.  | Ref. |
|
|
zoom in
| Organism | Trifolium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Narasimhachari,Proc.Indian Acad.Sci.,35A,(1952),202 |
|---|
|