| Name |
Sophoricoside Genistein 4'-O-glucoside |
| Formula |
C21H20O10 |
| Mw |
432.10564686 |
| CAS RN |
152-95-4 |
| C_ID |
C00010105
, 
|
| InChIKey |
ISQRJFLLIDGZEP-RZRCBCMFNA-N |
| InChICode |
InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-3-1-9(2-4-11)12-8-29-14-6-10(23)5-13(24)16(14)17(12)25/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19-,20+,21-/m0/s1 |
| SMILES |
O=c1c(-c2ccc(O[C@H]3OC(CO)[C@H](O)C(O)C3O)cc2)coc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
|
|
zoom in
| Organism | Sophora japonica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Farkas,Tetrahedron Lett.,(1964),3919 |
|---|
|