| Name |
8-O-Methylretusin 7-O-glucoside |
| Formula |
C23H24O10 |
| Mw |
460.13694699 |
| CAS RN |
68862-13-5 |
| C_ID |
C00010095
, 
|
| InChIKey |
WTXMHYXTGODDJX-KULBGAJJNA-N |
| InChICode |
InChI=1S/C23H24O10/c1-29-12-5-3-11(4-6-12)14-10-31-21-13(17(14)25)7-8-15(22(21)30-2)32-23-20(28)19(27)18(26)16(9-24)33-23/h3-8,10,16,18-20,23-24,26-28H,9H2,1-2H3/t16-,18-,19+,20-,23-/m1/s1 |
| SMILES |
COc1ccc(-c2coc3c(OC)c(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Cladrastis sikokiana | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Wisteria floribunda  | Ref. |
|
|
zoom in
| Organism | Wisteria floribunda | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ohashi,J.Jpn Wood Res.Soc.,24,(1978),750 |
|---|
|