| Name |
Licocoumarone |
| Formula |
C20H20O5 |
| Mw |
340.13107375 |
| CAS RN |
118524-14-4 |
| C_ID |
C00010076
, 
|
| InChIKey |
CNPMAFLUEHEXRE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O5/c1-11(2)4-6-14-17(23)10-19-15(20(14)24-3)9-18(25-19)13-7-5-12(21)8-16(13)22/h4-5,7-10,21-23H,6H2,1-3H3 |
| SMILES |
COc1c(CC=C(C)C)c(O)cc2oc(-c3ccc(O)cc3O)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Demizu,Chem.Pharm.Bull.,36,(1988),3474 |
|---|
|