| Name |
Erybraedin C (6aR,11aR)-3,9-Dihydroxy-4,8-diprenylpterocarpan |
| Formula |
C25H28O4 |
| Mw |
392.19875938 |
| CAS RN |
119269-74-8 |
| C_ID |
C00010014
, 
|
| InChIKey |
SAXBNTXROWQAKX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O4/c1-14(2)5-7-16-11-19-20-13-28-24-17(8-6-15(3)4)21(26)10-9-18(24)25(20)29-23(19)12-22(16)27/h5-6,9-12,20,25-27H,7-8,13H2,1-4H3/t20-,25-/m0/s1 |
| SMILES |
CC(C)=CCc1cc2c(cc1O)OC1c3ccc(O)c(CC=C(C)C)c3OCC21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bituminaria bituminosa | Ref. |
| Plantae | Fabaceae | Bituminaria morisiana | Ref. |
| Plantae | Fabaceae | Erythrina eriotriocha | Ref. |
| Plantae | Fabaceae | Erythrina mildbraedii | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
|
|
zoom in
| Organism | Erythrina mildbraedii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Mitscher,Phytochem.,27,(1988),3449 |
|---|
|