| Name |
3'-Dimethylallylkievitone 5,7,2',4'-Tetrahydroxy-8,3'-diprenylisoflavanone |
| Formula |
C25H28O6 |
| Mw |
424.18858863 |
| CAS RN |
348633-39-6 |
| C_ID |
C00009970
, 
|
| InChIKey |
FSHPJPOJLGCQOJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H28O6/c1-13(2)5-7-16-19(26)10-9-15(23(16)29)18-12-31-25-17(8-6-14(3)4)20(27)11-21(28)22(25)24(18)30/h5-6,9-11,18,26-29H,7-8,12H2,1-4H3/t18-/m1/s1 |
| SMILES |
CC(C)=CCc1c(O)ccc(C2COc3c(CC=C(C)C)c(O)cc(O)c3C2=O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Glycyrrhiza aspera | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
|
|
zoom in
| Organism | Phaseolus lunatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
O'Neill,Phytochem.,25,(1986),1315 |
|---|
|