| Name |
4'-O-Methylglabridin |
| Formula |
C21H22O4 |
| Mw |
338.15180919 |
| CAS RN |
68978-09-6 |
| C_ID |
C00009726
, 
|
| InChIKey |
ZZAIPFIGEGQNHP-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O4/c1-21(2)9-8-17-19(25-21)7-4-13-10-14(12-24-20(13)17)16-6-5-15(23-3)11-18(16)22/h4-9,11,14,22H,10,12H2,1-3H3/t14-/m0/s1 |
| SMILES |
COc1ccc(C2COc3c(ccc4c3C=CC(C)(C)O4)C2)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra var. typica  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
|
|
zoom in
| Organism | Glycyrrhiza uralensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|