| Name |
Isomucronulatol 7,2'-Dihydroxy-3',4'-dimethoxyisoflavan |
| Formula |
C17H18O5 |
| Mw |
302.11542369 |
| CAS RN |
64474-51-7 |
| C_ID |
C00009714
, 
|
| InChIKey |
NQRBAPDEZYMKFL-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H18O5/c1-20-14-6-5-13(16(19)17(14)21-2)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m1/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2)c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convallariaceae | Polygonatum kingianum  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Colutea arborescens | Ref. |
| Plantae | Fabaceae | Gliricidia sepium  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sphaerophysa salsula | Ref. |
|
|
zoom in
| Organism | Gliricidia sepium | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Jurd,J.Agric.Food.Chem.,25,(1977),723
Ingham,Phytochem.,16,(1977),1457 |
|---|
|