| Name |
1-Methoxyphaseollidin 3,9-Dihydroxy-1-methoxy-10-prenylpterocarpan |
| Formula |
C21H22O5 |
| Mw |
354.14672381 |
| CAS RN |
65428-13-9 |
| C_ID |
C00009654
, 
|
| InChIKey |
YKTZRMXYANFKQR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O5/c1-11(2)4-5-14-16(23)7-6-13-15-10-25-18-9-12(22)8-17(24-3)19(18)21(15)26-20(13)14/h4,6-9,15,21-23H,5,10H2,1-3H3/t15-,21+/m1/s1 |
| SMILES |
COc1cc(O)cc2c1C1Oc3c(ccc(O)c3CC=C(C)C)C1CO2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina vogelii | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Psophocarpus tetragonolobus  | Ref. |
|
|
zoom in
| Organism | Psophocarpus tetragonolobus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Preston,Phytochem.,16,(1977),2044 |
|---|
|