| Name |
Cyclokievitone |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
74175-82-9 |
| C_ID |
C00009558
, 
|
| InChIKey |
AWLFGFDTGPLHKG-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H18O6/c1-20(2)6-5-12-16(26-20)8-15(23)17-18(24)13(9-25-19(12)17)11-4-3-10(21)7-14(11)22/h3-8,13,21-23H,9H2,1-2H3/t13-/m1/s1 |
| SMILES |
CC1(C)C=Cc2c(cc(O)c3c2OCC(c2ccc(O)cc2O)C3=O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus lunatus  | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
|
|
zoom in
| Organism | Phaseolus vulgaris | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Woodward,Phytochem.,18,(1979),2007 |
|---|
|