| Name |
Sativanone 7-Hydroxy-2',4'-dimethoxyisoflavanone |
| Formula |
C17H16O5 |
| Mw |
300.09977362 |
| CAS RN |
70561-31-8 |
| C_ID |
C00009537
, 
|
| InChIKey |
JOVYBWHPTQRVNZ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C17H16O5/c1-20-11-4-6-12(15(8-11)21-2)14-9-22-16-7-10(18)3-5-13(16)17(14)19/h3-8,14,18H,9H2,1-2H3/t14-/m0/s1 |
| SMILES |
COc1ccc(C2COc3cc(O)ccc3C2=O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pleosporaceae | Helminthosporium cabonum | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
|
|
zoom in
| Organism | Medicago lupulina | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|