| Name |
Lupalbigenin 5,7,4'-Trihydroxy-6,3'-diprenylisoflavone |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
76754-24-0 |
| C_ID |
C00009515
, 
|
| InChIKey |
HTAZIHDXIUPDQP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)5-7-17-11-16(8-10-20(17)26)19-13-30-22-12-21(27)18(9-6-15(3)4)24(28)23(22)25(19)29/h5-6,8,10-13,26-28H,7,9H2,1-4H3 |
| SMILES |
CC(C)=CCc1cc(-c2coc3cc(O)c(CC=C(C)C)c(O)c3c2=O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex europaeus subsp. europaeus  | Ref. |
| - | - | Gaecinia dulcis | Ref. |
|
|
zoom in
| Organism | Millettia pachycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Singhal,Phytochem.,19,(1980),929 |
|---|
|