| Name |
Derrone |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
76166-59-1 |
| C_ID |
C00009493
, 
|
| InChIKey |
ZSYPWSSGRVZENH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O5/c1-20(2)8-7-13-16(25-20)9-15(22)17-18(23)14(10-24-19(13)17)11-3-5-12(21)6-4-11/h3-10,21-22H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc(O)c3c(=O)c(-c4ccc(O)cc4)coc23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Bolusanthus speciosus | Ref. |
| Plantae | Fabaceae | Calia arizonica | Ref. |
| Plantae | Fabaceae | Derris robusta | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Sophora arizonica | Ref. |
| Plantae | Moraceae | Ficus nymphaeifolia  | Ref. |
|
|
zoom in
| Organism | Derris robusta | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Chibber,Phytochem.,19,(1980),1857 |
|---|
|