| Name |
2'-Methoxybiochanin A 5,7-Dihydroxy-2',4'-dimethoxyisoflavone |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
61243-75-2 |
| C_ID |
C00009462
, 
|
| InChIKey |
PBUHDEMRGWYORH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-10-3-4-11(14(7-10)22-2)12-8-23-15-6-9(18)5-13(19)16(15)17(12)20/h3-8,18-19H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Myristicaceae | Virola caducifolia | Ref. |
| Plantae | Myristicaceae | Virola cadudifolia | Ref. |
| Plantae | Myristicaceae | Virola multinervia | Ref. |
|
|
zoom in
| Organism | Virola multinervia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braz Filho,Phytochem.,15,(1976),1029
Braz Filho,40,(1977),236 |
|---|
|