| Name |
2'-Hydroxybiochanin A 5,7,2'-Trihydroxy-4'-methoxyisoflavone |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
32884-35-8 |
| C_ID |
C00009457
, 
|
| InChIKey |
OZEVXMDBOINMTC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-9-2-3-10(12(18)6-9)11-7-22-14-5-8(17)4-13(19)15(14)16(11)20/h2-7,17-19H,1H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)cc(O)c3c2=O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Haplormosia monophylla | Ref. |
| Plantae | Moraceae | Ficus nymphaeifolia  | Ref. |
| Plantae | Myristicaceae | Virola caducifolia | Ref. |
| Plantae | Myristicaceae | Virola cadudifolia | Ref. |
| Plantae | Myristicaceae | Virola multinervia | Ref. |
|
|
zoom in
| Organism | Virola cadudifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Braz Filho,Phytochem.,15,(1976),1029
Braz Filho,40,(1977),236 |
|---|
|