| Name |
Barbigerone Lonchocarpusone |
| Formula |
C23H22O6 |
| Mw |
394.14163844 |
| CAS RN |
75425-27-3 |
| C_ID |
C00009444
, 
|
| InChIKey |
OBIUGMGQVQMVSK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C23H22O6/c1-23(2)9-8-13-17(29-23)7-6-14-21(24)16(12-28-22(13)14)15-10-19(26-4)20(27-5)11-18(15)25-3/h6-12H,1-5H3 |
| SMILES |
COc1cc(OC)c(-c2coc3c4c(ccc3c2=O)OC(C)(C)C=C4)cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Millettia ferruginea  | Ref. |
| Plantae | Fabaceae | Millettia taiwaniana | Ref. |
| Plantae | Fabaceae | Millettia usaramensis subsp. usaramensis  | Ref. |
| Plantae | Fabaceae | Tephrosia barbigera | Ref. |
|
|
zoom in
| Organism | Tephrosia barbigera | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Vilain,Phytochem.,19,(1980),988 |
|---|
|