| Name |
Odoratin |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
53948-00-8 |
| C_ID |
C00009407
, 
|
| InChIKey |
BYNYZQQDQIQLSO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-4-3-9(5-12(14)18)11-8-23-15-7-13(19)16(22-2)6-10(15)17(11)20/h3-8,18-19H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3cc(O)c(OC)cc3c2=O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Hymenoxys odorata | Ref. |
| Plantae | Fabaceae | Dalbergia frutescens | Ref. |
| Plantae | Fabaceae | Dalbergia parviflora  | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Pterodon apparicioi | Ref. |
| Plantae | Violaceae | Viola odorata  | Ref. |
|
|
zoom in
| Organism | Dipteryx odorata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Hayashi,Phytochem.,13,(1974),1943
Galina,Phytochem.,13,(1974),2593 |
|---|
|