| Name |
8-O-Methylretusin |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
37816-20-9 |
| C_ID |
C00009400
, 
|
| InChIKey |
SELGEUSJRWRBQR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)13-9-22-16-12(15(13)19)7-8-14(18)17(16)21-2/h3-9,18H,1-2H3 |
| SMILES |
COc1ccc(-c2coc3c(OC)c(O)ccc3c2=O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Cladrastis platycarpa | Ref. |
| Plantae | Fabaceae | Dalbergia frutescens | Ref. |
| Plantae | Fabaceae | Dalbergia retusa | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Euchresta horsfieldii  | Ref. |
| Plantae | Fabaceae | Millettia dielsiana | Ref. |
| Plantae | Fabaceae | Millettia reticulata  | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis  | Ref. |
| Plantae | Fabaceae | Sophora tetraptera  | Ref. |
| Plantae | Fabaceae | Wisteria brachybotrys | Ref. |
| Plantae | Fabaceae | Xanthocercis zambesiaca | Ref. |
|
|
zoom in
| Organism | Dipteryx odorata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Harper,Phytochem.,15,(1976),1019
Hayashi,Phytochem.,13,(1974),1943 |
|---|
|