| Name |
Epicatechin 5,7,3'-trimethyl ether |
| Formula |
C18H20O6 |
| Mw |
332.12598837 |
| CAS RN |
97914-19-7 |
| C_ID |
C00008815
, 
|
| InChIKey |
IJCWCJRLHJAVFD-SHTGXJIWNA-N |
| InChICode |
InChI=1S/C18H20O6/c1-21-11-7-15(22-2)12-9-14(20)18(24-16(12)8-11)10-4-5-13(19)17(6-10)23-3/h4-8,14,18-20H,9H2,1-3H3/t14-,18-/m1/s1 |
| SMILES |
COc1cc(OC)c2c(c1)O[C@H](c1ccc(O)c(OC)c1)[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Lauraceae | Cinnamomum obtusifolium | Ref. |
| Plantae | Lauraceae | Lindera umbellata var. membranacea  | Ref. |
|
|
zoom in
| Organism | Lindera umbellata var. membranacea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 355,Flavans and proanthocyanidins
Morimoto,Chem.Pharm.Bull.,33,(1985),2281 |
|---|
|