| Name |
(2R,3R)-Pinobanksin 3-acetate |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
52117-69-8 |
| C_ID |
C00008731
, 
|
| InChIKey |
BJYHZSNSMVEQEH-LQKAMQBPNA-N |
| InChICode |
InChI=1S/C17H14O6/c1-9(18)22-17-15(21)14-12(20)7-11(19)8-13(14)23-16(17)10-5-3-2-4-6-10/h2-8,16-17,19-20H,1H3/t16-,17-/m1/s1 |
| SMILES |
CC(=O)O[C@H]1C(=O)c2c(O)cc(O)cc2O[C@@H]1c1ccccc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baccharis trinervis  | Ref. |
| Plantae | Myricaceae | Comptonia peregrina  | Ref. |
| Plantae | Myricaceae | Myrica pensylvanica  | Ref. |
| Plantae | Pinaceae | Pinus armandii  | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Salicaceae | Populus gemma | Ref. |
| Plantae | Zingiberaceae | Alpinia japonica | Ref. |
|
|
zoom in
| Organism | Pinus armandii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 858,Flavanones and dihydroflavonols
Wollenweber,J.Plant Physiol.,117,(1985),423
Greenaway,Z.Naturforsch.C.,45,(1990),587 |
|---|
|