| Name |
Lupinifolinol |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
55890-28-3 |
| C_ID |
C00008621
, 
|
| InChIKey |
VRUKIMJALJVJOM-MMYMAHBINA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-10-17-23-16(11-12-25(3,4)31-23)19(27)18-20(28)21(29)22(30-24(17)18)14-6-8-15(26)9-7-14/h5-9,11-12,21-22,26-27,29H,10H2,1-4H3/t21-,22+/m0/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1O[C@H](c1ccc(O)cc1)[C@@H](O)C3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Macaranga conifera | Ref. |
| Plantae | Fabaceae | Eriosema chinense  | Ref. |
| Plantae | Fabaceae | Lonchocarpus guatemalensis | Ref. |
| Plantae | Fabaceae | Millettia pachycarpa | Ref. |
| Plantae | Fabaceae | Tephrosia lupinifolia | Ref. |
|
|
zoom in
| Organism | Millettia pachycarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 743,Flavanones and dihydroflavonols
Smallberger,Tetrahedron, 30,(1974),3927
Singhal,Phytochem.,19,(1980),929 |
|---|
|