| Name |
Mundulinol |
| Formula |
C25H26O5 |
| Mw |
406.17802394 |
| CAS RN |
71385-95-0 |
| C_ID |
C00008609
, 
|
| InChIKey |
UNYRLLNPZQFKTP-MMYMAHBINA-N |
| InChICode |
InChI=1S/C25H26O5/c1-14(2)10-11-17-23-16(12-13-25(3,4)30-23)19(26)18-20(27)21(28)22(29-24(17)18)15-8-6-5-7-9-15/h5-10,12-13,21-22,26,28H,11H2,1-4H3/t21-,22+/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c(O)c3c1O[C@H](c1ccccc1)[C@@H](O)C3=O)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Combretaceae | Bucida buceras  | Ref. |
| Plantae | Fabaceae | Lonchocarpus oaxacensis | Ref. |
| Plantae | Fabaceae | Mundulea chapelieri | Ref. |
| Plantae | Fabaceae | Mundulea sericea  | Ref. |
|
|
zoom in
| Organism | Mundulea sericea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 731,Flavanones and dihydroflavonols
Van Zyl.,J.Chem.Res.(S),3,(1979),97 |
|---|
|