| Name |
Dihydrorobinetin |
| Formula |
C15H12O7 |
| Mw |
304.05830274 |
| CAS RN |
4382-33-6 |
| C_ID |
C00008586
, 
|
| InChIKey |
VSJCDPYIMBSOKN-PVRQQBJHNA-N |
| InChICode |
InChI=1S/C15H12O7/c16-7-1-2-8-11(5-7)22-15(14(21)12(8)19)6-3-9(17)13(20)10(18)4-6/h1-5,14-18,20-21H/t14-,15-/m0/s1 |
| SMILES |
O=C1c2ccc(O)cc2O[C@H](c2cc(O)c(O)c(O)c2)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Schinopsis sp. | Ref. |
| Plantae | Fabaceae | Adenanthera pavonina  | Ref. |
| Plantae | Fabaceae | Gleditsia sp. | Ref. |
| Plantae | Fabaceae | Mimosa sp. | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Wisteria sp. | Ref. |
|
|
zoom in
| Organism | Mimosa sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 706,Flavanones and dihydroflavonols
Freudenberg,Liebigs Ann.Chem.,587,(1954),207
Gennaro,Phytochem.,11,(1972),1515 |
|---|
|