| Name |
(+)-Dihydroisorhamnetin Dihydroisorhamnetin |
| Formula |
C16H14O7 |
| Mw |
318.0739528 |
| CAS RN |
55812-91-4 |
| C_ID |
C00008579
, 
|
| InChIKey |
JWYULKXTGMJKKM-REIYMHPCNA-N |
| InChICode |
InChI=1S/C16H14O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,15-19,21H,1H3/t15-,16+/m0/s1 |
| SMILES |
COc1cc([C@H]2Oc3cc(O)cc(O)c3C(=O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe spp.  | Ref. |
| Plantae | Asteraceae | Urospermum dalechampii  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Zygophyllaceae | Larrea tridentata  | Ref. |
|
|
zoom in
| Organism | Dillenia indica | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 699,Flavanones and dihydroflavonols
Pavanasasivam,J.Chem.Soc.Perkin Trans.,1,(1975),612
Marco,Phytochem.,36,(1994),725 |
|---|
|