| Name |
Artocarpanone |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
520-25-2 |
| C_ID |
C00008362
, 
|
| InChIKey |
FQGBGNHGEUOZIW-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)10-3-2-8(17)4-11(10)18/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccc(O)cc1O)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Mimosa hostilis | Ref. |
| Plantae | Moraceae | Artocarpus champeden Spreng. | Ref. |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Moraceae | Artocarpus integrifolia  | Ref. |
|
|
zoom in
| Organism | Artocarpus integrifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 475,Flavanones and dihydroflavonols
Dava,J.Sci.Ind.Res.Indian,19B,(1960),470 |
|---|
|