| Name |
Sigmoidin C |
| Formula |
C20H18O6 |
| Mw |
354.11033831 |
| CAS RN |
101923-93-7 |
| C_ID |
C00008320
, 
|
| InChIKey |
RFBNSYVWJNUVHE-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C20H18O6/c1-20(2)4-3-10-5-11(6-15(24)19(10)26-20)16-9-14(23)18-13(22)7-12(21)8-17(18)25-16/h3-8,16,21-22,24H,9H2,1-2H3/t16-/m0/s1 |
| SMILES |
CC1(C)C=Cc2cc(C3CC(=O)c4c(O)cc(O)cc4O3)cc(O)c2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina eriotriocha | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
|
|
zoom in
| Organism | Erythrina sigmoidea | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 433,Flavanones and dihydroflavonols
Fomum,J.Chem.Soc.Perkin Trans.,1,(1986),33 |
|---|
|