| Name |
Sternbin 7-O-Methyleriodictyol |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
51857-11-5 |
| C_ID |
C00008304
, 
|
| InChIKey |
DSAJORLEPQBKDA-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-9-5-12(19)16-13(20)7-14(22-15(16)6-9)8-2-3-10(17)11(18)4-8/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia xanthochroa | Ref. |
| Plantae | Asteraceae | Blumea glomerata | Ref. |
| Plantae | Asteraceae | Holocarpha obconica | Ref. |
| Plantae | Asteraceae | Traversia baccharoides | Ref. |
| Plantae | Asteraceae | Wyethia glabra | Ref. |
| Plantae | Pteridaceae | Argyrochosma fendleri | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
|
|
zoom in
| Organism | Traversia baccharoides | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 417,Flavanones and dihydroflavonols
Wollenweber,Z.Naturforsch.C.,36,(1981),604
Babber,Indian J.Chem.Sect.B.,26,(1987),797 |
|---|
|