| Name |
Hesperetin 5-O-glucoside |
| Formula |
C22H24O11 |
| Mw |
464.13186161 |
| CAS RN |
69651-80-5 |
| C_ID |
C00008296
, 
|
| InChIKey |
QSLBWGKNSBMTJL-NFCALSJGNA-N |
| InChICode |
InChI=1S/C22H24O11/c1-30-13-3-2-9(4-11(13)25)14-7-12(26)18-15(31-14)5-10(24)6-16(18)32-22-21(29)20(28)19(27)17(8-23)33-22/h2-6,14,17,19-25,27-29H,7-8H2,1H3/t14-,17-,19+,20-,21+,22+/m0/s1 |
| SMILES |
COc1ccc(C2CC(=O)c3c(cc(O)cc3O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)O2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rosaceae | Prunus persica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Citrus spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 407,Flavanones and dihydroflavonols
Sadykov,Khim.Prir.Soedin,15,(1979),273 |
|---|
|