| Name |
Matteucinol |
| Formula |
C18H18O5 |
| Mw |
314.11542369 |
| CAS RN |
489-38-3 |
| C_ID |
C00008243
, 
|
| InChIKey |
DZTRDRPCROOSOG-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C18H18O5/c1-9-16(20)10(2)18-15(17(9)21)13(19)8-14(23-18)11-4-6-12(22-3)7-5-11/h4-7,14,20-21H,8H2,1-3H3/t14-/m0/s1 |
| SMILES |
COc1ccc(C2CC(=O)c3c(O)c(C)c(O)c(C)c3O2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dryopteridaceae | Dryopteris crassirhizoma | Ref. |
| Plantae | Ericaceae | Rhododendron simsii | Ref. |
| Plantae | Melastomataceae | Miconia trailii | Ref. |
| Plantae | Onocleaceae/Dryopteridaceae | Matteuccia orientalis  | Ref. |
|
|
zoom in
| Organism | Matteuccia orientalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 349,Flavanones and dihydroflavonols
Fujise,Sci.Papers Inst.Phys.Chem.Res.(Tokyo),11,(1929),111
Arthur,J.Chem.Soc.,(1954),2782 |
|---|
|