| Name |
Tephrinone 7-O-Methylglabranine 5-Hydroxy-7-methoxy-8-prenylflavanone |
| Formula |
C21H22O4 |
| Mw |
338.15180919 |
| CAS RN |
75350-44-6 |
| C_ID |
C00008177
, 
|
| InChIKey |
NISHDQWTPMJBJI-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C21H22O4/c1-13(2)9-10-15-19(24-3)12-17(23)20-16(22)11-18(25-21(15)20)14-7-5-4-6-8-14/h4-9,12,18,23H,10-11H2,1-3H3/t18-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1CC=C(C)C)OC(c1ccccc1)CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Tephrosia calophylla | Ref. |
| Plantae | Fabaceae | Tephrosia polyphylla | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
|
|
zoom in
| Organism | Tephrosia villosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rao,Curr.Scil,50,(1981),319 |
|---|
|