| Name |
4-(alpha-L-Rhamnopyranosyloxy)benzyl glucosinolate |
| Formula |
C20H29NO14S2 |
| Mw |
571.1029461 |
| CAS RN |
|
| C_ID |
C00007860
, 
|
| InChIKey |
DMPSBIMDSBBEQA-XOYXICKONA-N |
| InChICode |
InChI=1S/C20H29NO14S2/c1-8-13(23)15(25)17(27)19(32-8)33-10-4-2-9(3-5-10)6-12(21-35-37(29,30)31)36-20-18(28)16(26)14(24)11(7-22)34-20/h2-5,8,11,13-20,22-28H,6-7H2,1H3,(H,29,30,31)/b21-12-/t8-,11-,13-,14-,15-,16-,17+,18+,19-,20+/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2ccc(C/C(=N/OS(=O)(=O)O)S[C@H]3OC(CO)[C@H](O)C(O)[C@H]3O)cc2)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
|
|
zoom in
| Organism | Moringa stenopetala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|