| Name |
Desmethylisoxanthohumol |
| Formula |
C20H20O4 |
| Mw |
324.13615913 |
| CAS RN |
72247-78-0 |
| C_ID |
C00007078
, 
|
| InChIKey |
HDFDQMFITYCMDM-PKNBQFBNSA-N |
| InChICode |
InChI=1S/C20H20O4/c1-13(2)8-10-15-17(22)12-18(23)19(20(15)24)16(21)11-9-14-6-4-3-5-7-14/h3-9,11-12,22-24H,10H2,1-2H3/b11-9+ |
| SMILES |
CC(C)=CCc1c(O)cc(O)c(C(=O)/C=C/c2ccccc2)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Helichrysum athrixiifolium | Ref. |
| Plantae | Asteraceae | Helichrysum dregeanum | Ref. |
| Plantae | Asteraceae | Helichrysum felinum | Ref. |
| Plantae | Asteraceae | Helichrysum revolutum | Ref. |
| Plantae | Asteraceae | Helichrysum tenuifolium | Ref. |
| Plantae | Asteraceae | Metalasia cymbifolia | Ref. |
| Plantae | Asteraceae | Pleiotaxis spp. | Ref. |
|
|
zoom in
| Organism | Helichrysum revolutum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Bohlman,Phytochem.,18,(1979),1033
Bohlmann,Phytochem.,19,(1980),873 |
|---|
|