| Name |
Lanceolatin C Pongamol |
| Formula |
C18H14O4 |
| Mw |
294.08920894 |
| CAS RN |
484-33-3 |
| C_ID |
C00007018
, 
|
| InChIKey |
XTLSKKJNOIMMBK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H14O4/c1-21-18-13(7-8-17-14(18)9-10-22-17)16(20)11-15(19)12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
| SMILES |
COc1c(C(=O)CC(=O)c2ccccc2)ccc2occc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Cephalotaxaceae | Cephalotaxus lanceolata | Ref. |
| Plantae | Fabaceae | Dahlstedtia pinnata | Ref. |
| Plantae | Fabaceae | Millettia erythrocalyx | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia glabra  | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Tephrosia hamiltonii  | Ref. |
| Plantae | Fabaceae | Tephrosia lanceolata | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
|
|
zoom in
| Organism | Millettia pinnata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Talapatra,Phytochem,19,(1980),1199
Rajani,Phytochem.,27,(1988),648 |
|---|
|