| Name |
2',4',6'-Trihydroxychalcone Pinocenbrin chalcone |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
4197-97-1 |
| C_ID |
C00006933
, 
|
| InChIKey |
LOYXTWZXLWHMBX-VOTSOKGWSA-N |
| InChICode |
InChI=1S/C15H12O4/c16-11-8-13(18)15(14(19)9-11)12(17)7-6-10-4-2-1-3-5-10/h1-9,16,18-19H/b7-6+ |
| SMILES |
O=C(/C=C/c1ccccc1)c1c(O)cc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Chromolaena chasleae | Ref. |
| Plantae | Asteraceae | Helichrysum acutatum | Ref. |
| Plantae | Asteraceae | Helichrysum forskahlii  | Ref. |
| Plantae | Asteraceae | Helichrysum kraussii  | Ref. |
| Plantae | Asteraceae | Helichrysum polycladum | Ref. |
| Plantae | Asteraceae | Hymenoclea salsola | Ref. |
| Plantae | Pteridaceae | Adiantum sulphureum | Ref. |
| Plantae | Salicaceae | Populus angustifolia | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Salicaceae | Populus sieboldii | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
|
|
zoom in
| Organism | Helichrysum kraussii | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Wollenweber,Z.Pflanzephysiol.,69,(1973),125 |
|---|
|