| Name |
Petunidin 3-rutinoside-5-glucoside |
| Formula |
C34H43O21 |
| Mw |
787.22968344 |
| CAS RN |
40508-95-0 |
| C_ID |
C00006732
, 
|
| InChIKey |
MPTHMSBOMBFQPY-LSKXOBKSNA-O |
| InChICode |
InChI=1S/C34H42O21/c1-10-21(38)25(42)28(45)32(50-10)49-9-20-24(41)27(44)30(47)34(55-20)53-18-7-13-15(51-31(18)11-3-14(37)22(39)17(4-11)48-2)5-12(36)6-16(13)52-33-29(46)26(43)23(40)19(8-35)54-33/h3-7,10,19-21,23-30,32-35,38,40-47H,8-9H2,1-2H3,(H2-,36,37,39)/p+1/t10-,19-,20-,21+,23-,24-,25+,26+,27-,28-,29+,30-,32-,33-,34-/m1/s1 |
| SMILES |
COc1cc(-c2[o+]c3cc(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c3cc2O[C@@H]2OC(CO[C@@H]3OC(C)[C@H](O)[C@H](O)C3O)[C@@H](O)C(O)C2O)cc(O)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Berberidaceae | Berberis buxifolia  | Ref. |
| Plantae | Fabaceae | Vicia villosa  | Ref. |
| Plantae | Solanaceae | Petunia reitzii | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum nigrum L. var. guineense  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
|
|
zoom in
| Organism | Petunia x hybrida | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Pomilio,Phytochem.,12,(1973),218
Akavia,Z.Naturforsch.C.,36,(1981),378 |
|---|
|